C25H44O8 — CID 87661349
2,2-bis[2-(2,2-dimethylpropanoyloxy)ethyl]undecanedioic acid (PubChem CID 87661349) has the molecular formula C25H44O8 and a molecular weight of 472.62 g/mol. Its IUPAC name is 2,2-bis[2-(2,2-dimethylpropanoyloxy)ethyl]undecanedioic acid.
| Compound Name | 2,2-bis[2-(2,2-dimethylpropanoyloxy)ethyl]undecanedioic acid |
|---|---|
| PubChem CID | 87661349 |
| Molecular Formula | C25H44O8 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2,2-bis[2-(2,2-dimethylpropanoyloxy)ethyl]undecanedioic acid |
| SMILES | CC(C)(C)C(=O)OCCC(CCCCCCCCC(=O)O)(CCOC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H44O8/c1-23(2,3)21(30)32-17-15-25(20(28)29,16-18-33-22(31)24(4,5)6)14-12-10-8-7-9-11-13-19(26)27/h7-18H2,1-6H3,(H,26,27)(H,28,29) |
| InChIKey | HSJZUTZTWIPWAD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|