About naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium
naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium (PubChem CID 87661369) has the molecular formula C28H26O2S2Zr
and a molecular weight of 549.87 g/mol. Its IUPAC name is naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium.
Molecular Properties
| Compound Name | naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium |
| PubChem CID | 87661369 |
| Molecular Formula | C28H26O2S2Zr |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium |
| SMILES | O=C(O)C1CC2CC(Sc3ccc4ccccc4c3)C1C2.Sc1ccc2ccccc2c1.[Zr] |
| InChI | InChI=1S/C18H18O2S.C10H8S.Zr/c19-18(20)16-8-11-7-15(16)17(9-11)21-14-6-5-12-3-1-2-4-13(12)10-14;11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-6,10-11,15-17H,7-9H2,(H,19,20);1-7,11H; |
| InChIKey | XZRXVKUCOJCAMF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium?
The IUPAC name of naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium (CID 87661369) is naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium.
What is the SMILES notation for naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium?
The canonical SMILES for naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium is O=C(O)C1CC2CC(Sc3ccc4ccccc4c3)C1C2.Sc1ccc2ccccc2c1.[Zr].
What is the InChIKey of naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium?
The InChIKey is XZRXVKUCOJCAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2S.C10H8S.Zr/c19-18(20)16-8-11-7-15(16)17(9-11)21-14-6-5-12-3-1-2-4-13(12)10-14;11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-6,10-11,15-17H,7-9H2,(H,19,20);1-7,11H;.
What are the key properties of naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium?
naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium has a molecular weight of 549.87 g/mol, XLogP of 7.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-thiol;6-naphthalen-2-ylsulfanylbicyclo[2.2.1]heptane-2-carboxylic acid;zirconium is sourced from PubChem (CID 87661369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).