About 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine
1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine (PubChem CID 87661640) has the molecular formula C7H18N4
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine |
| PubChem CID | 87661640 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine |
| SMILES | CC=C(NCCN)NCCN |
| InChI | InChI=1S/C7H18N4/c1-2-7(10-5-3-8)11-6-4-9/h2,10-11H,3-6,8-9H2,1H3 |
| InChIKey | SEZNTUKXGIKFSE-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine?
The IUPAC name of 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine (CID 87661640) is 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine.
What is the SMILES notation for 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine?
The canonical SMILES for 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine is CC=C(NCCN)NCCN.
What is the InChIKey of 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine?
The InChIKey is SEZNTUKXGIKFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N4/c1-2-7(10-5-3-8)11-6-4-9/h2,10-11H,3-6,8-9H2,1H3.
What are the key properties of 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine?
1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine has a molecular weight of 158.25 g/mol, XLogP of -1.06, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N'-bis(2-aminoethyl)prop-1-ene-1,1-diamine is sourced from PubChem (CID 87661640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).