About 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide
3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide (PubChem CID 87661730) has the molecular formula C27H27F2N3O4S
and a molecular weight of 527.59 g/mol. Its IUPAC name is 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide |
| PubChem CID | 87661730 |
| Molecular Formula | C27H27F2N3O4S |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)N2CCC(=NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C27H27F2N3O4S/c1-31(2)27(33)21-4-3-5-25(18-21)37(34,35)32-16-14-24(15-17-32)30-36-26(19-6-10-22(28)11-7-19)20-8-12-23(29)13-9-20/h3-13,18,26H,14-17H2,1-2H3 |
| InChIKey | ANLUEQTVKBSCRS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide?
The IUPAC name of 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide (CID 87661730) is 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide?
The canonical SMILES for 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(S(=O)(=O)N2CCC(=NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1.
What is the InChIKey of 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide?
The InChIKey is ANLUEQTVKBSCRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27F2N3O4S/c1-31(2)27(33)21-4-3-5-25(18-21)37(34,35)32-16-14-24(15-17-32)30-36-26(19-6-10-22(28)11-7-19)20-8-12-23(29)13-9-20/h3-13,18,26H,14-17H2,1-2H3.
What are the key properties of 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide?
3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide has a molecular weight of 527.59 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[bis(4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonyl-N,N-dimethylbenzamide is sourced from PubChem (CID 87661730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).