About 1,3-diethyl-4,6-dimethylpyridine-2-thione
1,3-diethyl-4,6-dimethylpyridine-2-thione (PubChem CID 87662278) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is 1,3-diethyl-4,6-dimethylpyridine-2-thione.
Molecular Properties
| Compound Name | 1,3-diethyl-4,6-dimethylpyridine-2-thione |
| PubChem CID | 87662278 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1,3-diethyl-4,6-dimethylpyridine-2-thione |
| SMILES | CCc1c(C)cc(C)n(CC)c1=S |
| InChI | InChI=1S/C11H17NS/c1-5-10-8(3)7-9(4)12(6-2)11(10)13/h7H,5-6H2,1-4H3 |
| InChIKey | UGXJQGFOKRUFAG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-4,6-dimethylpyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-4,6-dimethylpyridine-2-thione?
The IUPAC name of 1,3-diethyl-4,6-dimethylpyridine-2-thione (CID 87662278) is 1,3-diethyl-4,6-dimethylpyridine-2-thione.
What is the SMILES notation for 1,3-diethyl-4,6-dimethylpyridine-2-thione?
The canonical SMILES for 1,3-diethyl-4,6-dimethylpyridine-2-thione is CCc1c(C)cc(C)n(CC)c1=S.
What is the InChIKey of 1,3-diethyl-4,6-dimethylpyridine-2-thione?
The InChIKey is UGXJQGFOKRUFAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS/c1-5-10-8(3)7-9(4)12(6-2)11(10)13/h7H,5-6H2,1-4H3.
What are the key properties of 1,3-diethyl-4,6-dimethylpyridine-2-thione?
1,3-diethyl-4,6-dimethylpyridine-2-thione has a molecular weight of 195.33 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-4,6-dimethylpyridine-2-thione is sourced from PubChem (CID 87662278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).