C26H33N3O5S — CID 87662607
N-[(7,8-dimethyl-2-oxo-3,4-dihydro-1H-quinolin-3-yl)methyl]-N-[(1R,2S)-2-hydroxycyclopentyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 87662607) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[(7,8-dimethyl-2-oxo-3,4-dihydro-1H-quinolin-3-yl)methyl]-N-[(1R,2S)-2-hydroxycyclopentyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-[(7,8-dimethyl-2-oxo-3,4-dihydro-1H-quinolin-3-yl)methyl]-N-[(1R,2S)-2-hydroxycyclopentyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 87662607 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(7,8-dimethyl-2-oxo-3,4-dihydro-1H-quinolin-3-yl)methyl]-N-[(1R,2S)-2-hydroxycyclopentyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | Cc1ccc2c(c1C)NC(=O)C(CN([C@@H]1CCC[C@@H]1O)S(=O)(=O)c1ccc3c(c1)OCCN3C)C2 |
| InChI | InChI=1S/C26H33N3O5S/c1-16-7-8-18-13-19(26(31)27-25(18)17(16)2)15-29(21-5-4-6-23(21)30)35(32,33)20-9-10-22-24(14-20)34-12-11-28(22)3/h7-10,14,19,21,23,30H,4-6,11-13,15H2,1-3H3,(H,27,31)/t19?,21-,23+/m1/s1 |
| InChIKey | NOEZGZIOXGTPQH-LVPCDLKWSA-N |
| XLogP | 2.85 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |