C18H24F3N3O5S — CID 87662638
ethyl 2-[1-[(2Z)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 87662638) has the molecular formula C18H24F3N3O5S and a molecular weight of 451.47 g/mol. Its IUPAC name is ethyl 2-[1-[(2Z)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[1-[(2Z)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87662638 |
| Molecular Formula | C18H24F3N3O5S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | ethyl 2-[1-[(2Z)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)Cc1cnn(C/C=C2/CNCCC2SC(C)=O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O3S.C2HF3O2/c1-3-22-16(21)8-13-9-18-19(11-13)7-5-14-10-17-6-4-15(14)23-12(2)20;3-2(4,5)1(6)7/h5,9,11,15,17H,3-4,6-8,10H2,1-2H3;(H,6,7)/b14-5-; |
| InChIKey | BXRAKXNZTLHLIN-MFGIPTIESA-N |
| XLogP | 2.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|