C17H24N2O6S2 — CID 8766278
methyl 3-[(2R)-1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl]sulfanylpropanoate (PubChem CID 8766278) has the molecular formula C17H24N2O6S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 3-[(2R)-1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(2R)-1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8766278 |
| Molecular Formula | C17H24N2O6S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | methyl 3-[(2R)-1-(4-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@H](C)C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H24N2O6S2/c1-13(26-12-7-16(20)24-2)17(21)18-14-3-5-15(6-4-14)27(22,23)19-8-10-25-11-9-19/h3-6,13H,7-12H2,1-2H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | MJFZGSIIBJZLQT-CYBMUJFWSA-N |
| XLogP | 1.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |