C21H25F6N3O7 — CID 87662977
6-[3-(2-aminoethylamino)propyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87662977) has the molecular formula C21H25F6N3O7 and a molecular weight of 545.43 g/mol. Its IUPAC name is 6-[3-(2-aminoethylamino)propyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-[3-(2-aminoethylamino)propyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87662977 |
| Molecular Formula | C21H25F6N3O7 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 6-[3-(2-aminoethylamino)propyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(CCCNCCN)ccc21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N3O3.2C2HF3O2/c1-2-20-11-14(17(22)23)16(21)13-10-12(5-6-15(13)20)4-3-8-19-9-7-18;2*3-2(4,5)1(6)7/h5-6,10-11,19H,2-4,7-9,18H2,1H3,(H,22,23);2*(H,6,7) |
| InChIKey | MHQKJWLSAWCAIZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 171.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|