C7H5F9O3S — CID 87663445
prop-2-enyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87663445) has the molecular formula C7H5F9O3S and a molecular weight of 340.16 g/mol. Its IUPAC name is prop-2-enyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | prop-2-enyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87663445 |
| Molecular Formula | C7H5F9O3S |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | prop-2-enyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | C=CCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O3S/c1-2-3-19-20(17,18)7(15,16)5(10,11)4(8,9)6(12,13)14/h2H,1,3H2 |
| InChIKey | WVBBMJJDRDHTBY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|