C45H48O8S — CID 87663590
[(2R,3S,4R,5R)-5-hydroxy-1-oxo-3,4,6-tris(phenylmethoxy)hexan-2-yl] 2,2-dimethyl-3-oxobutanoate;phenylsulfanylbenzene (PubChem CID 87663590) has the molecular formula C45H48O8S and a molecular weight of 748.94 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-hydroxy-1-oxo-3,4,6-tris(phenylmethoxy)hexan-2-yl] 2,2-dimethyl-3-oxobutanoate;phenylsulfanylbenzene.
| Compound Name | [(2R,3S,4R,5R)-5-hydroxy-1-oxo-3,4,6-tris(phenylmethoxy)hexan-2-yl] 2,2-dimethyl-3-oxobutanoate;phenylsulfanylbenzene |
|---|---|
| PubChem CID | 87663590 |
| Molecular Formula | C45H48O8S |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.31 |
| IUPAC Name | [(2R,3S,4R,5R)-5-hydroxy-1-oxo-3,4,6-tris(phenylmethoxy)hexan-2-yl] 2,2-dimethyl-3-oxobutanoate;phenylsulfanylbenzene |
| SMILES | CC(=O)C(C)(C)C(=O)O[C@@H](C=O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C33H38O8.C12H10S/c1-24(35)33(2,3)32(37)41-29(19-34)31(40-22-27-17-11-6-12-18-27)30(39-21-26-15-9-5-10-16-26)28(36)23-38-20-25-13-7-4-8-14-25;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-19,28-31,36H,20-23H2,1-3H3;1-10H/t28-,29+,30-,31-;/m1./s1 |
| InChIKey | GJNXBTWKEJOIRA-ZVHDPCOWSA-N |
| XLogP | 8.30 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|