C12H22O13S — CID 87663606
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfinylhexan-1-one (PubChem CID 87663606) has the molecular formula C12H22O13S and a molecular weight of 406.36 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfinylhexan-1-one.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfinylhexan-1-one |
|---|---|
| PubChem CID | 87663606 |
| Molecular Formula | C12H22O13S |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]sulfinylhexan-1-one |
| SMILES | O=C([C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)S(=O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O13S/c13-1-3(15)5(17)7(19)9(21)11(23)26(25)12(24)10(22)8(20)6(18)4(16)2-14/h3-10,13-22H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | IUBNDYDFHJUUMI-VCGUZZPXSA-N |
| XLogP | -7.34 |
| TPSA | 253.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | -7.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|