C37H44OZr — CID 87663626
cyclohexylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;2-(3-methylcyclopenta-1,4-dien-1-yl)furan (PubChem CID 87663626) has the molecular formula C37H44OZr and a molecular weight of 595.98 g/mol. Its IUPAC name is cyclohexylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;2-(3-methylcyclopenta-1,4-dien-1-yl)furan.
| Compound Name | cyclohexylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;2-(3-methylcyclopenta-1,4-dien-1-yl)furan |
|---|---|
| PubChem CID | 87663626 |
| Molecular Formula | C37H44OZr |
| Molecular Weight | 595.98 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | cyclohexylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;2-(3-methylcyclopenta-1,4-dien-1-yl)furan |
| SMILES | CC(C)(C)c1c[c-]c2c(c1)-c1cc(C(C)(C)C)ccc1C2.CC1[C-]=CC(c2ccco2)=C1.[Zr+2]=C1CCCCC1 |
| InChI | InChI=1S/C21H25.C10H9O.C6H10.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-8-4-5-9(7-8)10-3-2-6-11-10;1-2-4-6-5-3-1;/h7,9-10,12-13H,11H2,1-6H3;2-3,5-8H,1H3;1-5H2;/q2*-1;;+2 |
| InChIKey | XPOIGBYPBOMJFR-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.98 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|