4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid

C8H13F3N2O5 — CID 87663732

IUPAC4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid
SMILESNCCNC(=O)CCC(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O3.C2HF3O2/c7-3-4-8-5(9)1-2-6(10)11;3-2(4,5)1(6)7/h1-4,7H2,(H,8,9)(H,10,11);(H,6,7)
InChIKeyAJQVPRGLEMMGLY-UHFFFAOYSA-N
MW274.19 g/mol
LogP-0.44
Rot. Bonds5

About 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid

4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 87663732) has the molecular formula C8H13F3N2O5 and a molecular weight of 274.19 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid
PubChem CID87663732
Molecular FormulaC8H13F3N2O5
Molecular Weight274.19 g/mol
Exact Mass274.08
IUPAC Name4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid
SMILESNCCNC(=O)CCC(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O3.C2HF3O2/c7-3-4-8-5(9)1-2-6(10)11;3-2(4,5)1(6)7/h1-4,7H2,(H,8,9)(H,10,11);(H,6,7)
InChIKeyAJQVPRGLEMMGLY-UHFFFAOYSA-N
XLogP-0.44
TPSA129.72 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.19
LogP ≤ 5-0.44
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid (CID 87663732) is 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid is NCCNC(=O)CCC(=O)O.O=C(O)C(F)(F)F.
What is the InChIKey of 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid?
The InChIKey is AJQVPRGLEMMGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3.C2HF3O2/c7-3-4-8-5(9)1-2-6(10)11;3-2(4,5)1(6)7/h1-4,7H2,(H,8,9)(H,10,11);(H,6,7).
What are the key properties of 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid?
4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid has a molecular weight of 274.19 g/mol, XLogP of -0.44, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethylamino)-4-oxobutanoic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 87663732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).