C34H32F3N5O5 — CID 87663848
(2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoate (PubChem CID 87663848) has the molecular formula C34H32F3N5O5 and a molecular weight of 647.65 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87663848 |
| Molecular Formula | C34H32F3N5O5 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-pyridin-4-yl-2-[4-(pyridin-2-ylamino)butanoylamino]propanoyl]amino]propanoate |
| SMILES | O=C(CCCNc1ccccn1)N[C@H](Cc1ccncc1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32F3N5O5/c35-34(36,37)33(46)47-31(44)22-27(26-13-11-25(12-14-26)24-7-2-1-3-8-24)42-32(45)28(21-23-15-19-38-20-16-23)41-30(43)10-6-18-40-29-9-4-5-17-39-29/h1-5,7-9,11-17,19-20,27-28H,6,10,18,21-22H2,(H,39,40)(H,41,43)(H,42,45)/t27?,28-/m1/s1 |
| InChIKey | UUIKAVXRPRSYNJ-PLYLYKGUSA-N |
| XLogP | 4.94 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|