C39H40O6S — CID 87663962
(2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanal;phenylsulfanylbenzene (PubChem CID 87663962) has the molecular formula C39H40O6S and a molecular weight of 636.81 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanal;phenylsulfanylbenzene.
| Compound Name | (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanal;phenylsulfanylbenzene |
|---|---|
| PubChem CID | 87663962 |
| Molecular Formula | C39H40O6S |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanal;phenylsulfanylbenzene |
| SMILES | O=C[C@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O6.C12H10S/c28-16-24(29)26(32-18-22-12-6-2-7-13-22)27(33-19-23-14-8-3-9-15-23)25(30)20-31-17-21-10-4-1-5-11-21;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-16,24-27,29-30H,17-20H2;1-10H/t24-,25+,26+,27+;/m0./s1 |
| InChIKey | PDJUFNXUPPLSMX-XCDPNUBVSA-N |
| XLogP | 7.13 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|