C33H34O6S — CID 87663965
S-phenyl (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanethioate (PubChem CID 87663965) has the molecular formula C33H34O6S and a molecular weight of 558.70 g/mol. Its IUPAC name is S-phenyl (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanethioate.
| Compound Name | S-phenyl (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanethioate |
|---|---|
| PubChem CID | 87663965 |
| Molecular Formula | C33H34O6S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | S-phenyl (2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris(phenylmethoxy)hexanethioate |
| SMILES | O=C(Sc1ccccc1)[C@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C33H34O6S/c34-29(24-37-21-25-13-5-1-6-14-25)31(38-22-26-15-7-2-8-16-26)32(39-23-27-17-9-3-10-18-27)30(35)33(36)40-28-19-11-4-12-20-28/h1-20,29-32,34-35H,21-24H2/t29-,30-,31-,32-/m1/s1 |
| InChIKey | KMRWLQQVGYUNCQ-SEVDZJIVSA-N |
| XLogP | 5.41 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|