C18H18ClN5 — CID 87664229
5-(6-chloro-3-pyridinyl)-4-N-(2,4,6-trimethylphenyl)pyrimidine-2,4-diamine (PubChem CID 87664229) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-4-N-(2,4,6-trimethylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(6-chloro-3-pyridinyl)-4-N-(2,4,6-trimethylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87664229 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-4-N-(2,4,6-trimethylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C)c(Nc2nc(N)ncc2-c2ccc(Cl)nc2)c(C)c1 |
| InChI | InChI=1S/C18H18ClN5/c1-10-6-11(2)16(12(3)7-10)23-17-14(9-22-18(20)24-17)13-4-5-15(19)21-8-13/h4-9H,1-3H3,(H3,20,22,23,24) |
| InChIKey | ARIVYPJNRKWVBD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|