About 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid
4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid (PubChem CID 87664259) has the molecular formula C17H24ClNO3
and a molecular weight of 325.84 g/mol. Its IUPAC name is 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid |
| PubChem CID | 87664259 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(OCCCC2CCN(Cl)CC2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C17H24ClNO3/c1-12-10-15(11-13(2)16(12)17(20)21)22-9-3-4-14-5-7-19(18)8-6-14/h10-11,14H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | VTNQIMMVVGLPOP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid?
The IUPAC name of 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid (CID 87664259) is 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid is Cc1cc(OCCCC2CCN(Cl)CC2)cc(C)c1C(=O)O.
What is the InChIKey of 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid?
The InChIKey is VTNQIMMVVGLPOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClNO3/c1-12-10-15(11-13(2)16(12)17(20)21)22-9-3-4-14-5-7-19(18)8-6-14/h10-11,14H,3-9H2,1-2H3,(H,20,21).
What are the key properties of 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid?
4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid has a molecular weight of 325.84 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-chloropiperidin-4-yl)propoxy]-2,6-dimethylbenzoic acid is sourced from PubChem (CID 87664259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).