C23H40N4O3S2 — CID 87664416
(2R,5R)-3,6-diethoxy-2-[[[(2R,5R)-6-ethoxy-3-methyl-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyldisulfanyl]methyl]-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 87664416) has the molecular formula C23H40N4O3S2 and a molecular weight of 484.73 g/mol. Its IUPAC name is (2R,5R)-3,6-diethoxy-2-[[[(2R,5R)-6-ethoxy-3-methyl-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyldisulfanyl]methyl]-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2R,5R)-3,6-diethoxy-2-[[[(2R,5R)-6-ethoxy-3-methyl-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyldisulfanyl]methyl]-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 87664416 |
| Molecular Formula | C23H40N4O3S2 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (2R,5R)-3,6-diethoxy-2-[[[(2R,5R)-6-ethoxy-3-methyl-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyldisulfanyl]methyl]-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1CSSC[C@@H]1N=C(OCC)[C@@H](C(C)C)N=C1C |
| InChI | InChI=1S/C23H40N4O3S2/c1-9-28-21-18(26-23(30-11-3)20(27-21)15(6)7)13-32-31-12-17-16(8)24-19(14(4)5)22(25-17)29-10-2/h14-15,17-20H,9-13H2,1-8H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | PYZXFSPCIPKEQG-VNTMZGSJSA-N |
| XLogP | 4.95 |
| TPSA | 77.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|