About 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea
1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea (PubChem CID 8766476) has the molecular formula C12H20N4O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea.
Molecular Properties
| Compound Name | 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea |
| PubChem CID | 8766476 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C12H20N4O3S/c1-19-8-7-13-10(20)15-16-9(17)12(14-11(16)18)5-3-2-4-6-12/h2-8H2,1H3,(H,14,18)(H2,13,15,20) |
| InChIKey | OSQARPRRFOUUDH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea?
The IUPAC name of 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea (CID 8766476) is 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea.
What is the SMILES notation for 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea?
The canonical SMILES for 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea is COCCNC(=S)NN1C(=O)NC2(CCCCC2)C1=O.
What is the InChIKey of 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea?
The InChIKey is OSQARPRRFOUUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3S/c1-19-8-7-13-10(20)15-16-9(17)12(14-11(16)18)5-3-2-4-6-12/h2-8H2,1H3,(H,14,18)(H2,13,15,20).
What are the key properties of 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea?
1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea has a molecular weight of 300.38 g/mol, XLogP of 0.27, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(2-methoxyethyl)thiourea is sourced from PubChem (CID 8766476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).