About (Z)-2-ethylprop-1-ene-1,3-diamine
(Z)-2-ethylprop-1-ene-1,3-diamine (PubChem CID 87664762) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is (Z)-2-ethylprop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-2-ethylprop-1-ene-1,3-diamine |
| PubChem CID | 87664762 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (Z)-2-ethylprop-1-ene-1,3-diamine |
| SMILES | CC/C(=C/N)CN |
| InChI | InChI=1S/C5H12N2/c1-2-5(3-6)4-7/h3H,2,4,6-7H2,1H3/b5-3- |
| InChIKey | RGPFSFPLPVRIDP-HYXAFXHYSA-N |
| XLogP | 0.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-ethylprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-ethylprop-1-ene-1,3-diamine?
The IUPAC name of (Z)-2-ethylprop-1-ene-1,3-diamine (CID 87664762) is (Z)-2-ethylprop-1-ene-1,3-diamine.
What is the SMILES notation for (Z)-2-ethylprop-1-ene-1,3-diamine?
The canonical SMILES for (Z)-2-ethylprop-1-ene-1,3-diamine is CC/C(=C/N)CN.
What is the InChIKey of (Z)-2-ethylprop-1-ene-1,3-diamine?
The InChIKey is RGPFSFPLPVRIDP-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H12N2/c1-2-5(3-6)4-7/h3H,2,4,6-7H2,1H3/b5-3-.
What are the key properties of (Z)-2-ethylprop-1-ene-1,3-diamine?
(Z)-2-ethylprop-1-ene-1,3-diamine has a molecular weight of 100.16 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-ethylprop-1-ene-1,3-diamine is sourced from PubChem (CID 87664762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).