About 2-cyclohexylisoindole-1,3-dione;iodozinc(1+)
2-cyclohexylisoindole-1,3-dione;iodozinc(1+) (PubChem CID 87664820) has the molecular formula C14H14INO2Zn
and a molecular weight of 420.57 g/mol. Its IUPAC name is 2-cyclohexylisoindole-1,3-dione;iodozinc(1+).
Molecular Properties
| Compound Name | 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) |
| PubChem CID | 87664820 |
| Molecular Formula | C14H14INO2Zn |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) |
| SMILES | O=C1c2ccccc2C(=O)N1C1CC[CH-]CC1.[Zn+]I |
| InChI | InChI=1S/C14H14NO2.HI.Zn/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10;;/h1,4-5,8-10H,2-3,6-7H2;1H;/q-1;;+2/p-1 |
| InChIKey | HBWVDASVULQUGY-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylisoindole-1,3-dione;iodozinc(1+)?
The IUPAC name of 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) (CID 87664820) is 2-cyclohexylisoindole-1,3-dione;iodozinc(1+).
What is the SMILES notation for 2-cyclohexylisoindole-1,3-dione;iodozinc(1+)?
The canonical SMILES for 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) is O=C1c2ccccc2C(=O)N1C1CC[CH-]CC1.[Zn+]I.
What is the InChIKey of 2-cyclohexylisoindole-1,3-dione;iodozinc(1+)?
The InChIKey is HBWVDASVULQUGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H14NO2.HI.Zn/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10;;/h1,4-5,8-10H,2-3,6-7H2;1H;/q-1;;+2/p-1.
What are the key properties of 2-cyclohexylisoindole-1,3-dione;iodozinc(1+)?
2-cyclohexylisoindole-1,3-dione;iodozinc(1+) has a molecular weight of 420.57 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylisoindole-1,3-dione;iodozinc(1+) is sourced from PubChem (CID 87664820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).