C23H15ClF5IN2O3S — CID 87665113
(2,3,4,5,6-pentafluorophenyl) 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxylate (PubChem CID 87665113) has the molecular formula C23H15ClF5IN2O3S and a molecular weight of 656.80 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxylate |
|---|---|
| PubChem CID | 87665113 |
| Molecular Formula | C23H15ClF5IN2O3S |
| Molecular Weight | 656.80 g/mol |
| Exact Mass | 655.95 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboxylate |
| SMILES | CC1(C)CNC(=O)c2sc(Nc3ccc(I)cc3Cl)c(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)c2C1 |
| InChI | InChI=1S/C23H15ClF5IN2O3S/c1-23(2)6-9-12(22(34)35-18-16(28)14(26)13(25)15(27)17(18)29)21(36-19(9)20(33)31-7-23)32-11-4-3-8(30)5-10(11)24/h3-5,32H,6-7H2,1-2H3,(H,31,33) |
| InChIKey | HGSXTCUJGIPAOI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|