C12H6F14 — CID 87665387
1,2,2,3,4,4,5,6,6,7,8,8,9,9-tetradecafluoro-10,10-dimethyladamantane (PubChem CID 87665387) has the molecular formula C12H6F14 and a molecular weight of 416.15 g/mol. Its IUPAC name is 1,2,2,3,4,4,5,6,6,7,8,8,9,9-tetradecafluoro-10,10-dimethyladamantane.
| Compound Name | 1,2,2,3,4,4,5,6,6,7,8,8,9,9-tetradecafluoro-10,10-dimethyladamantane |
|---|---|
| PubChem CID | 87665387 |
| Molecular Formula | C12H6F14 |
| Molecular Weight | 416.15 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 1,2,2,3,4,4,5,6,6,7,8,8,9,9-tetradecafluoro-10,10-dimethyladamantane |
| SMILES | CC1(C)C2(F)C(F)(F)C3(F)C(F)(F)C1(F)C(F)(F)C(F)(C2(F)F)C3(F)F |
| InChI | InChI=1S/C12H6F14/c1-3(2)4(13)8(17,18)6(15)10(21,22)5(3,14)11(23,24)7(16,9(4,19)20)12(6,25)26/h1-2H3 |
| InChIKey | YGVHKKNTHRECLO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |