C3F6N4 — CID 87665441
2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)tetrazole (PubChem CID 87665441) has the molecular formula C3F6N4 and a molecular weight of 206.05 g/mol. Its IUPAC name is 2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)tetrazole.
| Compound Name | 2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)tetrazole |
|---|---|
| PubChem CID | 87665441 |
| Molecular Formula | C3F6N4 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)tetrazole |
| SMILES | Fn1nnc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C3F6N4/c4-2(5,3(6,7)8)1-10-12-13(9)11-1 |
| InChIKey | BWIZDUUYUCGYCB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|