About potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate
potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate (PubChem CID 87665730) has the molecular formula C16H18KN3O3S
and a molecular weight of 371.50 g/mol. Its IUPAC name is potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate.
Molecular Properties
| Compound Name | potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate |
| PubChem CID | 87665730 |
| Molecular Formula | C16H18KN3O3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate |
| SMILES | NC1CCC(Sc2ccc3c(NOC(=O)[O-])nccc3c2)CC1.[K+] |
| InChI | InChI=1S/C16H19N3O3S.K/c17-11-1-3-12(4-2-11)23-13-5-6-14-10(9-13)7-8-18-15(14)19-22-16(20)21;/h5-9,11-12H,1-4,17H2,(H,18,19)(H,20,21);/q;+1/p-1 |
| InChIKey | DAUWULYJRBLIFG-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate?
The IUPAC name of potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate (CID 87665730) is potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate.
What is the SMILES notation for potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate?
The canonical SMILES for potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate is NC1CCC(Sc2ccc3c(NOC(=O)[O-])nccc3c2)CC1.[K+].
What is the InChIKey of potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate?
The InChIKey is DAUWULYJRBLIFG-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H19N3O3S.K/c17-11-1-3-12(4-2-11)23-13-5-6-14-10(9-13)7-8-18-15(14)19-22-16(20)21;/h5-9,11-12H,1-4,17H2,(H,18,19)(H,20,21);/q;+1/p-1.
What are the key properties of potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate?
potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate has a molecular weight of 371.50 g/mol, XLogP of -0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [[6-(4-aminocyclohexyl)sulfanylisoquinolin-1-yl]amino] carbonate is sourced from PubChem (CID 87665730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).