C3F5N5O2 — CID 87666212
5-nitro-2-(1,1,2,2,2-pentafluoroethyl)tetrazole (PubChem CID 87666212) has the molecular formula C3F5N5O2 and a molecular weight of 233.06 g/mol. Its IUPAC name is 5-nitro-2-(1,1,2,2,2-pentafluoroethyl)tetrazole.
| Compound Name | 5-nitro-2-(1,1,2,2,2-pentafluoroethyl)tetrazole |
|---|---|
| PubChem CID | 87666212 |
| Molecular Formula | C3F5N5O2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 5-nitro-2-(1,1,2,2,2-pentafluoroethyl)tetrazole |
| SMILES | O=[N+]([O-])c1nnn(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C3F5N5O2/c4-2(5,6)3(7,8)13-10-1(9-11-13)12(14)15 |
| InChIKey | XSNXHOKUYQCOPD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|