C31H27F6N3O2 — CID 87666400
3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-1H-indol-3-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide (PubChem CID 87666400) has the molecular formula C31H27F6N3O2 and a molecular weight of 587.56 g/mol. Its IUPAC name is 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-1H-indol-3-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide.
| Compound Name | 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-1H-indol-3-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 87666400 |
| Molecular Formula | C31H27F6N3O2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-1H-indol-3-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide |
| SMILES | Cc1[nH]c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2c1Cc1cccc(C(=O)N(C)CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C31H27F6N3O2/c1-18-24(25-16-22(10-11-27(25)39-18)29(42,30(32,33)34)31(35,36)37)15-19-6-5-7-20(14-19)28(41)40(2)13-12-21-17-38-26-9-4-3-8-23(21)26/h3-11,14,16-17,38-39,42H,12-13,15H2,1-2H3 |
| InChIKey | VAFZRXISRVHYRO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|