About 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea
1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea (PubChem CID 87666731) has the molecular formula C23H22F2N4O3S
and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea.
Molecular Properties
| Compound Name | 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea |
| PubChem CID | 87666731 |
| Molecular Formula | C23H22F2N4O3S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea |
| SMILES | CCCCOc1cc(N(S)C(=O)Nc2ccccc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C23H22F2N4O3S/c1-2-3-12-32-17-13-18(29(33)23(31)27-14-8-5-4-6-9-14)28-22(26)20(17)21(30)19-15(24)10-7-11-16(19)25/h4-11,13,33H,2-3,12H2,1H3,(H2,26,28)(H,27,31) |
| InChIKey | KKIBZVLOQZGTTP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea?
The IUPAC name of 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea (CID 87666731) is 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea.
What is the SMILES notation for 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea?
The canonical SMILES for 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea is CCCCOc1cc(N(S)C(=O)Nc2ccccc2)nc(N)c1C(=O)c1c(F)cccc1F.
What is the InChIKey of 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea?
The InChIKey is KKIBZVLOQZGTTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2N4O3S/c1-2-3-12-32-17-13-18(29(33)23(31)27-14-8-5-4-6-9-14)28-22(26)20(17)21(30)19-15(24)10-7-11-16(19)25/h4-11,13,33H,2-3,12H2,1H3,(H2,26,28)(H,27,31).
What are the key properties of 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea?
1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea has a molecular weight of 472.52 g/mol, XLogP of 5.24, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]-3-phenyl-1-sulfanylurea is sourced from PubChem (CID 87666731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).