About triphenylphosphane;tris(furan-2-yl)phosphane
triphenylphosphane;tris(furan-2-yl)phosphane (PubChem CID 87666733) has the molecular formula C30H24O3P2
and a molecular weight of 494.47 g/mol. Its IUPAC name is triphenylphosphane;tris(furan-2-yl)phosphane.
Molecular Properties
| Compound Name | triphenylphosphane;tris(furan-2-yl)phosphane |
| PubChem CID | 87666733 |
| Molecular Formula | C30H24O3P2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | triphenylphosphane;tris(furan-2-yl)phosphane |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1coc(P(c2ccco2)c2ccco2)c1 |
| InChI | InChI=1S/C18H15P.C12H9O3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12/h1-15H;1-9H |
| InChIKey | RFEZDYGEPFPGHZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylphosphane;tris(furan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylphosphane;tris(furan-2-yl)phosphane?
The IUPAC name of triphenylphosphane;tris(furan-2-yl)phosphane (CID 87666733) is triphenylphosphane;tris(furan-2-yl)phosphane.
What is the SMILES notation for triphenylphosphane;tris(furan-2-yl)phosphane?
The canonical SMILES for triphenylphosphane;tris(furan-2-yl)phosphane is c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1coc(P(c2ccco2)c2ccco2)c1.
What is the InChIKey of triphenylphosphane;tris(furan-2-yl)phosphane?
The InChIKey is RFEZDYGEPFPGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C12H9O3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12/h1-15H;1-9H.
What are the key properties of triphenylphosphane;tris(furan-2-yl)phosphane?
triphenylphosphane;tris(furan-2-yl)phosphane has a molecular weight of 494.47 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylphosphane;tris(furan-2-yl)phosphane is sourced from PubChem (CID 87666733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).