C21H25BrClN5O4 — CID 87667261
2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7-(4-methylpent-3-enyl)purin-8-one (PubChem CID 87667261) has the molecular formula C21H25BrClN5O4 and a molecular weight of 526.82 g/mol. Its IUPAC name is 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7-(4-methylpent-3-enyl)purin-8-one.
| Compound Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7-(4-methylpent-3-enyl)purin-8-one |
|---|---|
| PubChem CID | 87667261 |
| Molecular Formula | C21H25BrClN5O4 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7-(4-methylpent-3-enyl)purin-8-one |
| SMILES | COc1cc(Cn2c(=O)n(CCC=C(C)C)c3c(Cl)nc(N)nc32)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C21H25BrClN5O4/c1-11(2)7-6-8-27-15-18(23)25-20(24)26-19(15)28(21(27)29)10-12-9-13(30-3)16(31-4)17(32-5)14(12)22/h7,9H,6,8,10H2,1-5H3,(H2,24,25,26) |
| InChIKey | RTWRXYVXBHHGRB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|