C72H81N3O18 — CID 87667312
1,3,5-tris[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxy]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 87667312) has the molecular formula C72H81N3O18 and a molecular weight of 1276.44 g/mol. Its IUPAC name is 1,3,5-tris[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxy]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87667312 |
| Molecular Formula | C72H81N3O18 |
| Molecular Weight | 1276.44 g/mol |
| Exact Mass | 1275.55 |
| IUPAC Name | 1,3,5-tris[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(C)(O)C(=O)c1ccc(C(OCCn2c(=O)n(CCOC(c3ccc(C(=O)C(C)(C)O)cc3)c3ccc(C(=O)C(C)(C)O)cc3)c(=O)n(CCOC(c3ccc(C(=O)C(C)(C)O)cc3)c3ccc(C(=O)C(C)(C)O)cc3)c2=O)c2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C72H81N3O18/c1-67(2,85)58(76)49-25-13-43(14-26-49)55(44-15-27-50(28-16-44)59(77)68(3,4)86)91-40-37-73-64(82)74(38-41-92-56(45-17-29-51(30-18-45)60(78)69(5,6)87)46-19-31-52(32-20-46)61(79)70(7,8)88)66(84)75(65(73)83)39-42-93-57(47-21-33-53(34-22-47)62(80)71(9,10)89)48-23-35-54(36-24-48)63(81)72(11,12)90/h13-36,55-57,85-90H,37-42H2,1-12H3 |
| InChIKey | YGQSKYYEFPYTNQ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 317.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 93 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1276.44 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |