C8H2F12 — CID 87667428
1,1,1,4,4,5,6,7,7-nonafluoro-3-(trifluoromethyl)hepta-2,5-diene (PubChem CID 87667428) has the molecular formula C8H2F12 and a molecular weight of 326.08 g/mol. Its IUPAC name is 1,1,1,4,4,5,6,7,7-nonafluoro-3-(trifluoromethyl)hepta-2,5-diene.
| Compound Name | 1,1,1,4,4,5,6,7,7-nonafluoro-3-(trifluoromethyl)hepta-2,5-diene |
|---|---|
| PubChem CID | 87667428 |
| Molecular Formula | C8H2F12 |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 1,1,1,4,4,5,6,7,7-nonafluoro-3-(trifluoromethyl)hepta-2,5-diene |
| SMILES | FC(=C(F)C(F)(F)C(=CC(F)(F)F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C8H2F12/c9-3(5(11)12)4(10)7(16,17)2(8(18,19)20)1-6(13,14)15/h1,5H |
| InChIKey | GKJSGUSJMDYWBR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|