C7H9F6NO2 — CID 87667614
methyl (2S)-2-(difluoroamino)-2,3,3,4-tetrafluoro-4-methylpentanoate (PubChem CID 87667614) has the molecular formula C7H9F6NO2 and a molecular weight of 253.14 g/mol. Its IUPAC name is methyl (2S)-2-(difluoroamino)-2,3,3,4-tetrafluoro-4-methylpentanoate.
| Compound Name | methyl (2S)-2-(difluoroamino)-2,3,3,4-tetrafluoro-4-methylpentanoate |
|---|---|
| PubChem CID | 87667614 |
| Molecular Formula | C7H9F6NO2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | methyl (2S)-2-(difluoroamino)-2,3,3,4-tetrafluoro-4-methylpentanoate |
| SMILES | COC(=O)[C@@](F)(N(F)F)C(F)(F)C(C)(C)F |
| InChI | InChI=1S/C7H9F6NO2/c1-5(2,8)7(10,11)6(9,14(12)13)4(15)16-3/h1-3H3/t6-/m1/s1 |
| InChIKey | PKMQGXGAGWPUBR-ZCFIWIBFSA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|