C21H23FN2O4 — CID 87667708
2-(4-fluoro-2-hydroxyphenyl)-4-[2-hydroxy-4-(4-methylpiperazin-1-yl)phenyl]-3-oxobutanal (PubChem CID 87667708) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-(4-fluoro-2-hydroxyphenyl)-4-[2-hydroxy-4-(4-methylpiperazin-1-yl)phenyl]-3-oxobutanal.
| Compound Name | 2-(4-fluoro-2-hydroxyphenyl)-4-[2-hydroxy-4-(4-methylpiperazin-1-yl)phenyl]-3-oxobutanal |
|---|---|
| PubChem CID | 87667708 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(4-fluoro-2-hydroxyphenyl)-4-[2-hydroxy-4-(4-methylpiperazin-1-yl)phenyl]-3-oxobutanal |
| SMILES | CN1CCN(c2ccc(CC(=O)C(C=O)c3ccc(F)cc3O)c(O)c2)CC1 |
| InChI | InChI=1S/C21H23FN2O4/c1-23-6-8-24(9-7-23)16-4-2-14(19(26)12-16)10-20(27)18(13-25)17-5-3-15(22)11-21(17)28/h2-5,11-13,18,26,28H,6-10H2,1H3 |
| InChIKey | AINBGWDVKBBJRL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|