C21H20FNO3S — CID 87668188
4-[(Z)-3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-hydroxyiminoprop-1-enyl]-3-fluorobenzoic acid (PubChem CID 87668188) has the molecular formula C21H20FNO3S and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[(Z)-3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-hydroxyiminoprop-1-enyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(Z)-3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-hydroxyiminoprop-1-enyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 87668188 |
| Molecular Formula | C21H20FNO3S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[(Z)-3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3-hydroxyiminoprop-1-enyl]-3-fluorobenzoic acid |
| SMILES | CC1(C)CCSc2ccc(C(/C=C\c3ccc(C(=O)O)cc3F)=NO)cc21 |
| InChI | InChI=1S/C21H20FNO3S/c1-21(2)9-10-27-19-8-6-14(11-16(19)21)18(23-26)7-5-13-3-4-15(20(24)25)12-17(13)22/h3-8,11-12,26H,9-10H2,1-2H3,(H,24,25)/b7-5-,23-18? |
| InChIKey | SHPDCSICIQGOQI-UPPABOTBSA-N |
| XLogP | 5.19 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|