C22H28N4O4 — CID 8766844
(2R)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 8766844) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2R)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 8766844 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2R)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](c2ccccc2)N(C)CC(=O)NC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N4O4/c1-15-11-12-17(18(13-15)26(29)30)23-21(28)20(16-9-7-6-8-10-16)25(5)14-19(27)24-22(2,3)4/h6-13,20H,14H2,1-5H3,(H,23,28)(H,24,27)/t20-/m1/s1 |
| InChIKey | UOBNUTOSAACNHV-HXUWFJFHSA-N |
| XLogP | 3.43 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|