C10H12F4N2 — CID 87668495
1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 87668495) has the molecular formula C10H12F4N2 and a molecular weight of 236.21 g/mol. Its IUPAC name is 1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)piperazine.
| Compound Name | 1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 87668495 |
| Molecular Formula | C10H12F4N2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | FC1(F)C=CC=C(N2CCNCC2)C1(F)F |
| InChI | InChI=1S/C10H12F4N2/c11-9(12)3-1-2-8(10(9,13)14)16-6-4-15-5-7-16/h1-3,15H,4-7H2 |
| InChIKey | XIHBIYCEYLRJKR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|