C21H13F6NO3 — CID 87668509
4-[bis[3-(trifluoromethyl)phenyl]methyl]-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 87668509) has the molecular formula C21H13F6NO3 and a molecular weight of 441.33 g/mol. Its IUPAC name is 4-[bis[3-(trifluoromethyl)phenyl]methyl]-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-[bis[3-(trifluoromethyl)phenyl]methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 87668509 |
| Molecular Formula | C21H13F6NO3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 4-[bis[3-(trifluoromethyl)phenyl]methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(C(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)cc[nH]c1=O |
| InChI | InChI=1S/C21H13F6NO3/c22-20(23,24)13-5-1-3-11(9-13)16(12-4-2-6-14(10-12)21(25,26)27)15-7-8-28-18(29)17(15)19(30)31/h1-10,16H,(H,28,29)(H,30,31) |
| InChIKey | SQKLVXSFIPFLOD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |