About 2-chloro-4-ethylpyridine;piperazine
2-chloro-4-ethylpyridine;piperazine (PubChem CID 87668747) has the molecular formula C11H18ClN3
and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-chloro-4-ethylpyridine;piperazine.
Molecular Properties
| Compound Name | 2-chloro-4-ethylpyridine;piperazine |
| PubChem CID | 87668747 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-chloro-4-ethylpyridine;piperazine |
| SMILES | C1CNCCN1.CCc1ccnc(Cl)c1 |
| InChI | InChI=1S/C7H8ClN.C4H10N2/c1-2-6-3-4-9-7(8)5-6;1-2-6-4-3-5-1/h3-5H,2H2,1H3;5-6H,1-4H2 |
| InChIKey | JHJYRTFITDFTKC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-ethylpyridine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-ethylpyridine;piperazine?
The IUPAC name of 2-chloro-4-ethylpyridine;piperazine (CID 87668747) is 2-chloro-4-ethylpyridine;piperazine.
What is the SMILES notation for 2-chloro-4-ethylpyridine;piperazine?
The canonical SMILES for 2-chloro-4-ethylpyridine;piperazine is C1CNCCN1.CCc1ccnc(Cl)c1.
What is the InChIKey of 2-chloro-4-ethylpyridine;piperazine?
The InChIKey is JHJYRTFITDFTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C4H10N2/c1-2-6-3-4-9-7(8)5-6;1-2-6-4-3-5-1/h3-5H,2H2,1H3;5-6H,1-4H2.
What are the key properties of 2-chloro-4-ethylpyridine;piperazine?
2-chloro-4-ethylpyridine;piperazine has a molecular weight of 227.74 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-ethylpyridine;piperazine is sourced from PubChem (CID 87668747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).