About carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate
carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate (PubChem CID 87668781) has the molecular formula C8H16N2S4
and a molecular weight of 268.50 g/mol. Its IUPAC name is carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate.
Molecular Properties
| Compound Name | carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate |
| PubChem CID | 87668781 |
| Molecular Formula | C8H16N2S4 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate |
| SMILES | CC(C)C(C)(C)NC(=S)SSC(N)=S |
| InChI | InChI=1S/C8H16N2S4/c1-5(2)8(3,4)10-7(12)14-13-6(9)11/h5H,1-4H3,(H2,9,11)(H,10,12) |
| InChIKey | AXNMTFLPTJNZOR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate?
The IUPAC name of carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate (CID 87668781) is carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate.
What is the SMILES notation for carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate?
The canonical SMILES for carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate is CC(C)C(C)(C)NC(=S)SSC(N)=S.
What is the InChIKey of carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate?
The InChIKey is AXNMTFLPTJNZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S4/c1-5(2)8(3,4)10-7(12)14-13-6(9)11/h5H,1-4H3,(H2,9,11)(H,10,12).
What are the key properties of carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate?
carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate has a molecular weight of 268.50 g/mol, XLogP of 2.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioylsulfanyl N-(2,3-dimethylbutan-2-yl)carbamodithioate is sourced from PubChem (CID 87668781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).