C23H23ClF4N2 — CID 87668854
N-[(2-chloroquinolin-4-yl)methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methylphenyl)-4-methylpentan-2-amine (PubChem CID 87668854) has the molecular formula C23H23ClF4N2 and a molecular weight of 438.90 g/mol. Its IUPAC name is N-[(2-chloroquinolin-4-yl)methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methylphenyl)-4-methylpentan-2-amine.
| Compound Name | N-[(2-chloroquinolin-4-yl)methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methylphenyl)-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 87668854 |
| Molecular Formula | C23H23ClF4N2 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[(2-chloroquinolin-4-yl)methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methylphenyl)-4-methylpentan-2-amine |
| SMILES | Cc1ccc(F)cc1C(C)(C)CC(NCc1cc(Cl)nc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C23H23ClF4N2/c1-14-8-9-16(25)11-18(14)22(2,3)12-20(23(26,27)28)29-13-15-10-21(24)30-19-7-5-4-6-17(15)19/h4-11,20,29H,12-13H2,1-3H3 |
| InChIKey | XWDWOCOIAFCJLB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|