About 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde
2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde (PubChem CID 87669320) has the molecular formula C22H42O5
and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde |
| PubChem CID | 87669320 |
| Molecular Formula | C22H42O5 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde |
| SMILES | CCCCCCCCCCC(OCOC)C1CCCO1.O=CC1CCCO1 |
| InChI | InChI=1S/C17H34O3.C5H8O2/c1-3-4-5-6-7-8-9-10-12-17(20-15-18-2)16-13-11-14-19-16;6-4-5-2-1-3-7-5/h16-17H,3-15H2,1-2H3;4-5H,1-3H2 |
| InChIKey | QYSHCTAYDDJNAJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde?
The IUPAC name of 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde (CID 87669320) is 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde.
What is the SMILES notation for 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde?
The canonical SMILES for 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde is CCCCCCCCCCC(OCOC)C1CCCO1.O=CC1CCCO1.
What is the InChIKey of 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde?
The InChIKey is QYSHCTAYDDJNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3.C5H8O2/c1-3-4-5-6-7-8-9-10-12-17(20-15-18-2)16-13-11-14-19-16;6-4-5-2-1-3-7-5/h16-17H,3-15H2,1-2H3;4-5H,1-3H2.
What are the key properties of 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde?
2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde has a molecular weight of 386.57 g/mol, XLogP of 5.05, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(methoxymethoxy)undecyl]oxolane;oxolane-2-carbaldehyde is sourced from PubChem (CID 87669320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).