C8H9F6NO3 — CID 87669501
(2S)-2-fluoro-2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (PubChem CID 87669501) has the molecular formula C8H9F6NO3 and a molecular weight of 281.15 g/mol. Its IUPAC name is (2S)-2-fluoro-2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.
| Compound Name | (2S)-2-fluoro-2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 87669501 |
| Molecular Formula | C8H9F6NO3 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (2S)-2-fluoro-2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
| SMILES | C[C@@](F)(C(=O)O)C(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F6NO3/c1-6(9,5(17)18)4(16)15-3-2-7(10,11)8(12,13)14/h2-3H2,1H3,(H,15,16)(H,17,18)/t6-/m0/s1 |
| InChIKey | NDCKQNFIMRBDSA-LURJTMIESA-N |
| XLogP | 1.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|