About N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide)
N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) (PubChem CID 87669612) has the molecular formula C5H13F6N3O4S2
and a molecular weight of 357.30 g/mol. Its IUPAC name is N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide).
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) |
| PubChem CID | 87669612 |
| Molecular Formula | C5H13F6N3O4S2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) |
| SMILES | CN(C)C.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H9N.2CH2F3NO2S/c1-4(2)3;2*2-1(3,4)8(5,6)7/h1-3H3;2*(H2,5,6,7) |
| InChIKey | PIEDKGFMXMQHKO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide)?
The IUPAC name of N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) (CID 87669612) is N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide).
What is the SMILES notation for N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide)?
The canonical SMILES for N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) is CN(C)C.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide)?
The InChIKey is PIEDKGFMXMQHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.2CH2F3NO2S/c1-4(2)3;2*2-1(3,4)8(5,6)7/h1-3H3;2*(H2,5,6,7).
What are the key properties of N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide)?
N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) has a molecular weight of 357.30 g/mol, XLogP of -0.23, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;bis(trifluoromethanesulfonamide) is sourced from PubChem (CID 87669612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).