C59H86O8S5 — CID 87669738
bis(3-[bis(sulfanyl)methyl]-6-tert-butyl-2,4-dimethylphenol);4-[2,6-ditert-butyl-4-[[2-(6-methylheptoxy)-2-oxoethyl]sulfanylmethyl]phenoxy]carbonylbenzoic acid (PubChem CID 87669738) has the molecular formula C59H86O8S5 and a molecular weight of 1083.66 g/mol. Its IUPAC name is bis(3-[bis(sulfanyl)methyl]-6-tert-butyl-2,4-dimethylphenol);4-[2,6-ditert-butyl-4-[[2-(6-methylheptoxy)-2-oxoethyl]sulfanylmethyl]phenoxy]carbonylbenzoic acid.
| Compound Name | bis(3-[bis(sulfanyl)methyl]-6-tert-butyl-2,4-dimethylphenol);4-[2,6-ditert-butyl-4-[[2-(6-methylheptoxy)-2-oxoethyl]sulfanylmethyl]phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 87669738 |
| Molecular Formula | C59H86O8S5 |
| Molecular Weight | 1083.66 g/mol |
| Exact Mass | 1082.49 |
| IUPAC Name | bis(3-[bis(sulfanyl)methyl]-6-tert-butyl-2,4-dimethylphenol);4-[2,6-ditert-butyl-4-[[2-(6-methylheptoxy)-2-oxoethyl]sulfanylmethyl]phenoxy]carbonylbenzoic acid |
| SMILES | CC(C)CCCCCOC(=O)CSCc1cc(C(C)(C)C)c(OC(=O)c2ccc(C(=O)O)cc2)c(C(C)(C)C)c1.Cc1cc(C(C)(C)C)c(O)c(C)c1C(S)S.Cc1cc(C(C)(C)C)c(O)c(C)c1C(S)S |
| InChI | InChI=1S/C33H46O6S.2C13H20OS2/c1-22(2)12-10-9-11-17-38-28(34)21-40-20-23-18-26(32(3,4)5)29(27(19-23)33(6,7)8)39-31(37)25-15-13-24(14-16-25)30(35)36;2*1-7-6-9(13(3,4)5)11(14)8(2)10(7)12(15)16/h13-16,18-19,22H,9-12,17,20-21H2,1-8H3,(H,35,36);2*6,12,14-16H,1-5H3 |
| InChIKey | CGWAXKNKDYUWLG-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.66 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|