C14H11BF7N — CID 87670514
difluoro-(2,3,4,5,6-pentafluorophenyl)borane;N,N-dimethylaniline (PubChem CID 87670514) has the molecular formula C14H11BF7N and a molecular weight of 337.05 g/mol. Its IUPAC name is difluoro-(2,3,4,5,6-pentafluorophenyl)borane;N,N-dimethylaniline.
| Compound Name | difluoro-(2,3,4,5,6-pentafluorophenyl)borane;N,N-dimethylaniline |
|---|---|
| PubChem CID | 87670514 |
| Molecular Formula | C14H11BF7N |
| Molecular Weight | 337.05 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | difluoro-(2,3,4,5,6-pentafluorophenyl)borane;N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1.FB(F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H11N.C6BF7/c1-9(2)8-6-4-3-5-7-8;8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h3-7H,1-2H3; |
| InChIKey | JWARJVJBLFETKJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.05 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|