About CID 87670752
CID 87670752 (PubChem CID 87670752) has the molecular formula C9H20BN2O4P
and a molecular weight of 262.05 g/mol.
Molecular Properties
| Compound Name | CID 87670752 |
| PubChem CID | 87670752 |
| Molecular Formula | C9H20BN2O4P |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | — |
| SMILES | [B]C1CN(OP(=O)(OC)N(C)C)CC(CC)O1 |
| InChI | InChI=1S/C9H20BN2O4P/c1-5-8-6-12(7-9(10)15-8)16-17(13,14-4)11(2)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | JVSFZFRNJLJOQY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 87670752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87670752?
The IUPAC name of CID 87670752 (CID 87670752) is not available.
What is the SMILES notation for CID 87670752?
The canonical SMILES for CID 87670752 is [B]C1CN(OP(=O)(OC)N(C)C)CC(CC)O1.
What is the InChIKey of CID 87670752?
The InChIKey is JVSFZFRNJLJOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20BN2O4P/c1-5-8-6-12(7-9(10)15-8)16-17(13,14-4)11(2)3/h8-9H,5-7H2,1-4H3.
What are the key properties of CID 87670752?
CID 87670752 has a molecular weight of 262.05 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87670752 is sourced from PubChem (CID 87670752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).