About (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one
(3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one (PubChem CID 87670755) has the molecular formula C8H9F3N4O
and a molecular weight of 234.18 g/mol. Its IUPAC name is (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one.
Molecular Properties
| Compound Name | (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one |
| PubChem CID | 87670755 |
| Molecular Formula | C8H9F3N4O |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one |
| SMILES | Cn1nccc1C(=O)C/C(=N/N)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N4O/c1-15-5(2-3-13-15)6(16)4-7(14-12)8(9,10)11/h2-3H,4,12H2,1H3/b14-7- |
| InChIKey | VCCGOEUFSDXPEA-AUWJEWJLSA-N |
| XLogP | 0.87 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one?
The IUPAC name of (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one (CID 87670755) is (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one.
What is the SMILES notation for (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one?
The canonical SMILES for (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one is Cn1nccc1C(=O)C/C(=N/N)C(F)(F)F.
What is the InChIKey of (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one?
The InChIKey is VCCGOEUFSDXPEA-AUWJEWJLSA-N. The full InChI is InChI=1S/C8H9F3N4O/c1-15-5(2-3-13-15)6(16)4-7(14-12)8(9,10)11/h2-3H,4,12H2,1H3/b14-7-.
What are the key properties of (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one?
(3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one has a molecular weight of 234.18 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4,4,4-trifluoro-3-hydrazinylidene-1-(2-methylpyrazol-3-yl)butan-1-one is sourced from PubChem (CID 87670755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).